CAS 6526-72-3 appears in our catalog under these names: 2-Nitrocumene, 95%, 2–Nitrocumene, 2-Nitrocumene, >97.0%(GC), 2-Nitrocumene 95%, 1-Isopropyl-2-nitrobenzene, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg.
1-nitro-2-propan-2-ylbenzene (CAS 6526-72-3) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 1-nitro-2-propan-2-ylbenzene. InChIKey: BSMKYQUHXQAVKG-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 1-nitro-2-propan-2-ylbenzene |
| InChIKey | BSMKYQUHXQAVKG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)