cas: 133639-29-9 — see every product listed under this CAS number, including other names
1-Isopropyl-3-methyl-1H-pyrazole-5-carbonyl chloride, 98% (CAS 133639-29-9) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A278229-5g |
| cas | 133639-29-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 12764.50 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-methyl-2-propan-2-ylpyrazole-3-carbonyl chloride (CAS 133639-29-9) is a chemical compound with the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. IUPAC name: 5-methyl-2-propan-2-ylpyrazole-3-carbonyl chloride. InChIKey: SEMQKJMNZZCDSJ-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O |
|---|---|
| Molecular weight | 186.64 g/mol |
| IUPAC name | 5-methyl-2-propan-2-ylpyrazole-3-carbonyl chloride |
| InChIKey | SEMQKJMNZZCDSJ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(=O)Cl)C(C)C |
Computed by PubChem (NCBI)