CAS 60079-51-8 appears in our catalog under these names: (S)-2-Amino-2-phenylacetamide hydrochloride, 98%, H–Phg–NH₂ · HCl, H-L-Phg-NH2*HCl. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech. Available pack sizes: 1g, 25g, 100g, 5g.
(2S)-2-amino-2-phenylacetamide;hydrochloride (CAS 60079-51-8) is a chemical compound with the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. IUPAC name: (2S)-2-amino-2-phenylacetamide;hydrochloride. InChIKey: LXOAFHGMXCFTOU-FJXQXJEOSA-N.
| Molecular formula | C8H11ClN2O |
|---|---|
| Molecular weight | 186.64 g/mol |
| IUPAC name | (2S)-2-amino-2-phenylacetamide;hydrochloride |
| InChIKey | LXOAFHGMXCFTOU-FJXQXJEOSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)