Products 133639-29-9
CAS 133639-29-9 appears in our catalog under these names: 1-Isopropyl-3-methyl-1h-pyrazole-5-carbonyl chloride, 95%, 1-Isopropyl-3-methyl-1H-pyrazole-5-carbonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-methyl-2-propan-2-ylpyrazole-3-carbonyl chloride (CAS 133639-29-9) is a chemical compound with the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. IUPAC name: 5-methyl-2-propan-2-ylpyrazole-3-carbonyl chloride. InChIKey: SEMQKJMNZZCDSJ-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O |
|---|---|
| Molecular weight | 186.64 g/mol |
| IUPAC name | 5-methyl-2-propan-2-ylpyrazole-3-carbonyl chloride |
| InChIKey | SEMQKJMNZZCDSJ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(=O)Cl)C(C)C |
Computed by PubChem (NCBI)