cas: 1817-47-6 — see every product listed under this CAS number, including other names
1-Isopropyl-4-nitrobenzene 95% (CAS 1817-47-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A418989-1g |
| cas | 1817-47-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 515.00 Pln | |
| Ambeed | 25g | 1138.00 Pln | |
| Ambeed | 100g | 2806.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A418989 |
1-nitro-4-propan-2-ylbenzene (CAS 1817-47-6) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 1-nitro-4-propan-2-ylbenzene. InChIKey: JXMYUMNAEKRMIP-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 1-nitro-4-propan-2-ylbenzene |
| InChIKey | JXMYUMNAEKRMIP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)