CAS 1817-47-6 appears in our catalog under these names: 1-Isopropyl-4-nitrobenzene, 98%, 4–Nitrocumene, 4-Nitrocumene, >98.0%(GC), 1-Isopropyl-4-nitrobenzene 95%, 4-Nitrocumene, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 10g, 100g.
1-nitro-4-propan-2-ylbenzene (CAS 1817-47-6) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 1-nitro-4-propan-2-ylbenzene. InChIKey: JXMYUMNAEKRMIP-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 1-nitro-4-propan-2-ylbenzene |
| InChIKey | JXMYUMNAEKRMIP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)