cas: 1142-15-0 — see every product listed under this CAS number, including other names
1-Methoxy-4-styrylbenzene (CAS 1142-15-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ASR-1g |
| cas | 1142-15-0 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1389.20 Pln |
| delivery time | 3 weeks |
|---|
1-methoxy-4-(2-phenylethenyl)benzene (CAS 1142-15-0) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: 1-methoxy-4-(2-phenylethenyl)benzene. InChIKey: XWYXLYCDZKRCAD-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 1-methoxy-4-(2-phenylethenyl)benzene |
| InChIKey | XWYXLYCDZKRCAD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C=CC2=CC=CC=C2 |
Computed by PubChem (NCBI)