CAS 1140-16-5 appears in our catalog under these names: (2-Methylphenyl)(4-methylphenyl)methanone, 95%, 2,4'-Dimethylbenzophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
(2-methylphenyl)-(4-methylphenyl)methanone (CAS 1140-16-5) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: (2-methylphenyl)-(4-methylphenyl)methanone. InChIKey: IKCBNUVGOJSNDB-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | (2-methylphenyl)-(4-methylphenyl)methanone |
| InChIKey | IKCBNUVGOJSNDB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2C |
Computed by PubChem (NCBI)