cas: 75092-39-6 — see every product listed under this CAS number, including other names
1-Methyl-1H-pyrazole-3,5-dicarboxylic acid, 95%, 95% (CAS 75092-39-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3RA-100mg |
| cas | 75092-39-6 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 1g | 1792.40 Pln | |
| Chemat | 5g | 6117.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-methylpyrazole-3,5-dicarboxylic acid (CAS 75092-39-6) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 1-methylpyrazole-3,5-dicarboxylic acid. InChIKey: MFKWUVYTAQKQMF-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 1-methylpyrazole-3,5-dicarboxylic acid |
| InChIKey | MFKWUVYTAQKQMF-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)