Products 91933-54-9

CAS 91933-54-9 is the registry number for [(5-Methylisoxazol-3-yl)amino](oxo)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoacetic acid (CAS 91933-54-9) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoacetic acid. InChIKey: YQLZGIZUEZWTTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N2O4
Molecular weight170.12 g/mol
IUPAC name2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoacetic acid
InChIKeyYQLZGIZUEZWTTQ-UHFFFAOYSA-N
SMILESCC1=CC(=NO1)NC(=O)C(=O)O

Computed by PubChem (NCBI)