Products 705-36-2

CAS 705-36-2 is the registry number for 1-Methyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

3-methyl-2,6-dioxopyrimidine-4-carboxylic acid (CAS 705-36-2) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 3-methyl-2,6-dioxopyrimidine-4-carboxylic acid. InChIKey: HRHMKAOOSCBQKD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N2O4
Molecular weight170.12 g/mol
IUPAC name3-methyl-2,6-dioxopyrimidine-4-carboxylic acid
InChIKeyHRHMKAOOSCBQKD-UHFFFAOYSA-N
SMILESCN1C(=CC(=O)NC1=O)C(=O)O

Computed by PubChem (NCBI)