cas: 850567-47-4 — see every product listed under this CAS number, including other names
1-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole, 95% (CAS 850567-47-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225290-1G |
| cas | 850567-47-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 10g | 1226.67 Pln | |
| Fluorochem | 25g | 2736.55 Pln | |
| Fluorochem | 100g | 10796.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 850567-47-4) is a chemical compound with the molecular formula C11H18BNO2 and a molecular weight of 207.08 g/mol. IUPAC name: 1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: OEQQEXKRORJZPR-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO2 |
|---|---|
| Molecular weight | 207.08 g/mol |
| IUPAC name | 1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| InChIKey | OEQQEXKRORJZPR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CN2C |
Computed by PubChem (NCBI)