Products 220999-48-4

CAS 220999-48-4 appears in our catalog under these names: 4–((Diethylamino)methyl)phenylboronic Acid, 4-((Diethylamino)methyl)phenylboronic Acid, 95+%, 4-(N,N-Diethylaminomethyl)benzeneboronic acid, 95%. Offered by: GLPBio, AmBeed, Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

[4-(diethylaminomethyl)phenyl]boronic acid (CAS 220999-48-4) is a chemical compound with the molecular formula C11H18BNO2 and a molecular weight of 207.08 g/mol. IUPAC name: [4-(diethylaminomethyl)phenyl]boronic acid. InChIKey: WGXUKAGOUGPEOL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18BNO2
Molecular weight207.08 g/mol
IUPAC name[4-(diethylaminomethyl)phenyl]boronic acid
InChIKeyWGXUKAGOUGPEOL-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)CN(CC)CC)(O)O

Computed by PubChem (NCBI)