CAS 2797245-03-3 is the registry number for (Z)-5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enenitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enenitrile (CAS 2797245-03-3) is a chemical compound with the molecular formula C11H18BNO2 and a molecular weight of 207.08 g/mol. IUPAC name: (Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enenitrile. InChIKey: GMSPRWFBVXMBOR-VURMDHGXSA-N.
| Molecular formula | C11H18BNO2 |
|---|---|
| Molecular weight | 207.08 g/mol |
| IUPAC name | (Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enenitrile |
| InChIKey | GMSPRWFBVXMBOR-VURMDHGXSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C\CCC#N |
Computed by PubChem (NCBI)