cas: 1247000-92-5 — see every product listed under this CAS number, including other names
1-Methyl-4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidine, 95%, 95% (CAS 1247000-92-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111MNI-100mg |
| cas | 1247000-92-5 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1106.00 Pln | |
| Chemat | 25g | 4398.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine (CAS 1247000-92-5) is a chemical compound with the molecular formula C18H28BNO2 and a molecular weight of 301.2 g/mol. IUPAC name: 1-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine. InChIKey: UMZNHRTZPNOQHN-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO2 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | 1-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
| InChIKey | UMZNHRTZPNOQHN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CCN(CC3)C |
Computed by PubChem (NCBI)