CAS 1366131-49-8 is the registry number for 3-Methyl-4-(piperidin-1-yl)phenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
1-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine (CAS 1366131-49-8) is a chemical compound with the molecular formula C18H28BNO2 and a molecular weight of 301.2 g/mol. IUPAC name: 1-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine. InChIKey: AATUHVLQZIQRGE-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO2 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | 1-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
| InChIKey | AATUHVLQZIQRGE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N3CCCCC3)C |
Computed by PubChem (NCBI)