CAS 2096331-44-9 appears in our catalog under these names: 4-(N-Cyclopentylaminomethyl)phenylboronic acid, pinacol ester, 96%, 4-(N-Cyclopentylaminomethyl)phenylboronic acid, pinacol ester, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine (CAS 2096331-44-9) is a chemical compound with the molecular formula C18H28BNO2 and a molecular weight of 301.2 g/mol. IUPAC name: N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine. InChIKey: DZGHHMMOOILENW-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO2 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine |
| InChIKey | DZGHHMMOOILENW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CNC3CCCC3 |
Computed by PubChem (NCBI)