cas: 70261-81-3 — see every product listed under this CAS number, including other names
1-Methyl-4-(4-nitrobenzyl)piperazine, ≥98%, ≥98% (CAS 70261-81-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116WLU-250mg |
| cas | 70261-81-3 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 971.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
1-methyl-4-[(4-nitrophenyl)methyl]piperazine (CAS 70261-81-3) is a chemical compound with the molecular formula C12H17N3O2 and a molecular weight of 235.28 g/mol. IUPAC name: 1-methyl-4-[(4-nitrophenyl)methyl]piperazine. InChIKey: TZZWNVPIAQKNTG-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O2 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 1-methyl-4-[(4-nitrophenyl)methyl]piperazine |
| InChIKey | TZZWNVPIAQKNTG-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)