cas: 2684308-79-8 — see every product listed under this CAS number, including other names
1-Methyl-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole 95% (CAS 2684308-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A107907-100mg |
| cas | 2684308-79-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 898.81 Pln | |
| Ambeed | 1g | 2144.81 Pln | |
| Ambeed | 5g | 6917.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A107907 |
1-methyl-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2684308-79-8) is a chemical compound with the molecular formula C16H21BN2O2 and a molecular weight of 284.2 g/mol. IUPAC name: 1-methyl-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: ILZWJQFSUBJUHI-UHFFFAOYSA-N.
| Molecular formula | C16H21BN2O2 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | 1-methyl-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | ILZWJQFSUBJUHI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N(N=C2)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)