CAS 2364587-02-8 is the registry number for 1-Methyl-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole (CAS 2364587-02-8) is a chemical compound with the molecular formula C16H21BN2O2 and a molecular weight of 284.2 g/mol. IUPAC name: 1-methyl-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole. InChIKey: XMCYSVQFCSOBHU-UHFFFAOYSA-N.
| Molecular formula | C16H21BN2O2 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | 1-methyl-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole |
| InChIKey | XMCYSVQFCSOBHU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C(=N2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)