CAS 2246863-75-0 is the registry number for 2-((1H-Imidazol-1-yl)methyl)phenylboronic acid, pinacol ester, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazole (CAS 2246863-75-0) is a chemical compound with the molecular formula C16H21BN2O2 and a molecular weight of 284.2 g/mol. IUPAC name: 1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazole. InChIKey: IMZLSJUUDSKWEZ-UHFFFAOYSA-N.
| Molecular formula | C16H21BN2O2 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | 1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazole |
| InChIKey | IMZLSJUUDSKWEZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CN3C=CN=C3 |
Computed by PubChem (NCBI)