1-Methyl-7-nitroisatoic anhydride, 98%
cas: 73043-80-8 — see every product listed under this CAS number, including other names
1-Methyl-7-nitroisatoic anhydride, 98% (CAS 73043-80-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 1mg, 5mg, 100mg, 5g, 10mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A228759-250mg |
| cas | 73043-80-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 704.12 Pln | |
| Ambeed | 1g | 1761.00 Pln | |
| Chemat | 1mg | 98.00 Pln | |
| Chemat | 5mg | 150.80 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1960.40 Pln | |
| Chemat | 5g | 7643.60 Pln | |
| BLDpharm | 1mg | 136.64 Pln | |
| BLDpharm | 5mg | 186.63 Pln | |
| BLDpharm | 10mg | 225.50 Pln | |
| BLDpharm | 100mg | 525.40 Pln | |
| BLDpharm | 250mg | 753.09 Pln | |
| BLDpharm | 1g | 1897.13 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-methyl-7-nitroisatoic anhydride is a 3,1-benzoxazin-1,4-dione having an N-methyl substituent and a nitro group at the 7-position. It is a C-nitro compound and a benzoxazine.
Source: ChEBI
| Molecular formula | C9H6N2O5 |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | 1-methyl-7-nitro-3,1-benzoxazine-2,4-dione |
| InChIKey | MULNCJWAVSDEKJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)[N+](=O)[O-])C(=O)OC1=O |
Computed by PubChem (NCBI)
Synonyms:
1-methyl-7-nitroisatoic anhydride, 7-nitro-1-methyl-1H-benzo[d][1,3]oxazine-2,4-dione, 1-methyl-7-nitro-2H-3,1-benzoxazine-2,4(1H)-dione, 1-methyl-7-nitro-3,1-benzoxazine-2,4-dione, 1-Methyl-7-nitroisatoicanhydride, 1-methyl-7-nitro-1H-benzo[d][1,3]oxazine-2,4-dione, 1-methyl-7-nitro-2h-benzo[d][1,3]oxazine-2,4(1h)-dione, orb1219756, orb1308736, 1-Methyl-7-nitroisatoic anhydride?