CAS 185689-39-8 is the registry number for 5-Methyl-6-nitro-2H-benzo[d][1,3]oxazine-2,4(1H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-6-nitro-1H-3,1-benzoxazine-2,4-dione (CAS 185689-39-8) is a chemical compound with the molecular formula C9H6N2O5 and a molecular weight of 222.15 g/mol. IUPAC name: 5-methyl-6-nitro-1H-3,1-benzoxazine-2,4-dione. InChIKey: RTSIZCSHAVXMTC-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O5 |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | 5-methyl-6-nitro-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | RTSIZCSHAVXMTC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=O)OC(=O)N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)