CAS 2137795-63-0 is the registry number for 6-(methoxycarbonyl)oxazolo[4,5-b]pyridine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methoxycarbonyl-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid (CAS 2137795-63-0) is a chemical compound with the molecular formula C9H6N2O5 and a molecular weight of 222.15 g/mol. IUPAC name: 6-methoxycarbonyl-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid. InChIKey: JNCQFTVHPPXYMN-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O5 |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | 6-methoxycarbonyl-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid |
| InChIKey | JNCQFTVHPPXYMN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N=C1)N=C(O2)C(=O)O |
Computed by PubChem (NCBI)