cas: 915226-44-7 — see every product listed under this CAS number, including other names
1-N-Boc-3-(R)-Cyanopiperidine, 95%, 95% (CAS 915226-44-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117LDS-250mg |
| cas | 915226-44-7 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 500mg | 218.00 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1062.80 Pln | |
| Chemat | 10g | 1883.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R)-3-cyanopiperidine-1-carboxylate (CAS 915226-44-7) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: tert-butyl (3R)-3-cyanopiperidine-1-carboxylate. InChIKey: UEFZTXGFHKPSFS-VIFPVBQESA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | tert-butyl (3R)-3-cyanopiperidine-1-carboxylate |
| InChIKey | UEFZTXGFHKPSFS-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C#N |
Computed by PubChem (NCBI)