cas: 374930-88-8 — see every product listed under this CAS number, including other names
1-N-Boc-4-(5-Bromopyrimidin-2-yl)piperazine, 95% (CAS 374930-88-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048495-5G |
| cas | 374930-88-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 534.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate (CAS 374930-88-8) is a chemical compound with the molecular formula C13H19BrN4O2 and a molecular weight of 343.22 g/mol. IUPAC name: tert-butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate. InChIKey: UKCBGXCNXOKVTF-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN4O2 |
|---|---|
| Molecular weight | 343.22 g/mol |
| IUPAC name | tert-butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate |
| InChIKey | UKCBGXCNXOKVTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)