CAS 1197294-73-7 is the registry number for tert-Butyl 4-(6-bromopyrazin-2-yl)piperazine-1-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
Tert-butyl 4-(6-bromopyrazin-2-yl)piperazine-1-carboxylate (CAS 1197294-73-7) is a chemical compound with the molecular formula C13H19BrN4O2 and a molecular weight of 343.22 g/mol. IUPAC name: tert-butyl 4-(6-bromopyrazin-2-yl)piperazine-1-carboxylate. InChIKey: VFKDPAYRRKJKKR-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN4O2 |
|---|---|
| Molecular weight | 343.22 g/mol |
| IUPAC name | tert-butyl 4-(6-bromopyrazin-2-yl)piperazine-1-carboxylate |
| InChIKey | VFKDPAYRRKJKKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CN=CC(=N2)Br |
Computed by PubChem (NCBI)