CAS 374930-88-8 appears in our catalog under these names: tert-Butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate 98%, 1-N-Boc-4-(5-Bromopyrimidin-2-yl)piperazine, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
Tert-butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate (CAS 374930-88-8) is a chemical compound with the molecular formula C13H19BrN4O2 and a molecular weight of 343.22 g/mol. IUPAC name: tert-butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate. InChIKey: UKCBGXCNXOKVTF-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN4O2 |
|---|---|
| Molecular weight | 343.22 g/mol |
| IUPAC name | tert-butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate |
| InChIKey | UKCBGXCNXOKVTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)