CAS 43038-45-5 appears in our catalog under these names: 1–Naphthohydrazide, 1-Naphthoic hydrazide, 98+% , 1-Naphthohydrazide, >98.0%(GC)(T), alpha-Naphthoylhydrazine, 1-Naphthohydrazide 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
Naphthalene-1-carbohydrazide (CAS 43038-45-5) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: naphthalene-1-carbohydrazide. InChIKey: VMFUMDXVTKTZQY-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | naphthalene-1-carbohydrazide |
| InChIKey | VMFUMDXVTKTZQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)NN |
Computed by PubChem (NCBI)