1-Naphthylboronic Acid, 98%
cas: 13922-41-3 — see every product listed under this CAS number, including other names
1-Naphthylboronic Acid, 98% (CAS 13922-41-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112AI0-1g |
| cas | 13922-41-3 |
| size | 1g |
| availability | 25000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 50g | 126.80 Pln | |
| Chemat | 100g | 194.00 Pln | |
| Chemat | 250g | 386.00 Pln | |
| Chemat | 500g | 782.40 Pln | |
| Chemat | 5kg | 5265.60 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Naphthalen-1-ylboronic acid (CAS 13922-41-3) is a chemical compound with the molecular formula C10H9BO2 and a molecular weight of 171.99 g/mol. IUPAC name: naphthalen-1-ylboronic acid. InChIKey: HUMMCEUVDBVXTQ-UHFFFAOYSA-N.
| Molecular formula | C10H9BO2 |
|---|---|
| Molecular weight | 171.99 g/mol |
| IUPAC name | naphthalen-1-ylboronic acid |
| InChIKey | HUMMCEUVDBVXTQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC2=CC=CC=C12)(O)O |
Computed by PubChem (NCBI)