1-Nitro-2-(trifluoromethoxy)benzene, 98%
cas: 1644-88-8 — see every product listed under this CAS number, including other names
1-Nitro-2-(trifluoromethoxy)benzene, 98% (CAS 1644-88-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A209449-25g |
| cas | 1644-88-8 |
| size | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 359.25 Pln | |
| Ambeed | 500g | 1366.06 Pln | |
| Ambeed | 1kg | 2328.38 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 362.00 Pln | |
| Chemat | 500g | 1353.60 Pln | |
| BLDpharm | 25g | 169.96 Pln | |
| BLDpharm | 100g | 386.56 Pln | |
| BLDpharm | 500g | 1469.51 Pln | |
| BLDpharm | 1kg | 2508.03 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-nitro-2-(trifluoromethoxy)benzene (CAS 1644-88-8) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 1-nitro-2-(trifluoromethoxy)benzene. InChIKey: YTWBYJAWWKTPOV-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 1-nitro-2-(trifluoromethoxy)benzene |
| InChIKey | YTWBYJAWWKTPOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC(F)(F)F |
Computed by PubChem (NCBI)
