Products 1221171-81-8
CAS 1221171-81-8 appears in our catalog under these names: 3-(Trifluoromethoxy)picolinic acid, 95%, 3–(Trifluoromethoxy)picolinic acid, 3-(Trifluoromethoxy)picolinic acid 98%, 3-(Trifluoromethoxy)picolinic acid, 98%, 98%, 3-(Trifluoromethoxy)picolinic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 25mg, 5g, 500mg.
3-(trifluoromethoxy)pyridine-2-carboxylic acid (CAS 1221171-81-8) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 3-(trifluoromethoxy)pyridine-2-carboxylic acid. InChIKey: UCVGCGJYBNVWKZ-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 3-(trifluoromethoxy)pyridine-2-carboxylic acid |
| InChIKey | UCVGCGJYBNVWKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)