CAS 1214326-22-3 appears in our catalog under these names: 2-(Difluoromethoxy)-3-fluoronitrobenzene, 97%, 2–(Difluoromethoxy)–1–fluoro–3–nitrobenzene, 2-(Difluoromethoxy)-1-fluoro-3-nitro-benzene, 95%. Offered by: AmBeed, GLPBio, Combi-blocks. Available pack sizes: 5g, 100mg, 1g, 250mg.
2-(difluoromethoxy)-1-fluoro-3-nitrobenzene (CAS 1214326-22-3) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 2-(difluoromethoxy)-1-fluoro-3-nitrobenzene. InChIKey: IJEQFBATOJWEGM-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 2-(difluoromethoxy)-1-fluoro-3-nitrobenzene |
| InChIKey | IJEQFBATOJWEGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)