cas: 120218-45-3 — see every product listed under this CAS number, including other names
1-PHENYLCYCLOBUTYLAMINE HCL, 98% (CAS 120218-45-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305002-100MG |
| cas | 120218-45-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 825.77 Pln | |
| Fluorochem | 5g | 3236.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-phenylcyclobutan-1-amine;hydrochloride (CAS 120218-45-3) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: 1-phenylcyclobutan-1-amine;hydrochloride. InChIKey: IFVYFMNCNFMBGV-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | 1-phenylcyclobutan-1-amine;hydrochloride |
| InChIKey | IFVYFMNCNFMBGV-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)