CAS 244092-64-6 appears in our catalog under these names: (R)-1-Benzyl-allylamine hydrochloride, 95%, (R)–1–Phenylbut–3–en–2–amine hydrochloride, (R)-1-Phenylbut-3-en-2-amine hydrochloride, 95%, 95%, (R)-1-Phenylbut-3-en-2-amine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(2R)-1-phenylbut-3-en-2-amine;hydrochloride (CAS 244092-64-6) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (2R)-1-phenylbut-3-en-2-amine;hydrochloride. InChIKey: GMQARJHXPFBJRD-PPHPATTJSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (2R)-1-phenylbut-3-en-2-amine;hydrochloride |
| InChIKey | GMQARJHXPFBJRD-PPHPATTJSA-N |
| SMILES | C=C[C@@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)