cas: 287192-99-8 — see every product listed under this CAS number, including other names
1-PIPERIDINECARBOXYLIC ACID, 3-ETHYNYL-, 1,1-DIMETHYLETHYL ESTER, (3R)-, 97% (CAS 287192-99-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F534923-100MG |
| cas | 287192-99-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 841.39 Pln | |
| Fluorochem | 250mg | 1757.73 Pln | |
| Fluorochem | 500mg | 2939.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3R)-3-ethynylpiperidine-1-carboxylate (CAS 287192-99-8) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: tert-butyl (3R)-3-ethynylpiperidine-1-carboxylate. InChIKey: IJHRDEPFBAXIMW-JTQLQIEISA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | tert-butyl (3R)-3-ethynylpiperidine-1-carboxylate |
| InChIKey | IJHRDEPFBAXIMW-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)C#C |
Computed by PubChem (NCBI)