cas: 5321-62-0 — see every product listed under this CAS number, including other names
1-Phenethylpiperazine Dihydrochloride, 95%, 95% (CAS 5321-62-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AU5-250mg |
| cas | 5321-62-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(2-phenylethyl)piperazine;dihydrochloride (CAS 5321-62-0) is a chemical compound with the molecular formula C12H20Cl2N2 and a molecular weight of 263.20 g/mol. IUPAC name: 1-(2-phenylethyl)piperazine;dihydrochloride. InChIKey: JWSRGCWCXUCWBJ-UHFFFAOYSA-N.
| Molecular formula | C12H20Cl2N2 |
|---|---|
| Molecular weight | 263.20 g/mol |
| IUPAC name | 1-(2-phenylethyl)piperazine;dihydrochloride |
| InChIKey | JWSRGCWCXUCWBJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CCC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)