CAS 1185304-83-9 appears in our catalog under these names: (4-[2-(1-Pyrrolidinyl)ethyl]phenyl)amine dihydrochloride, 95%, {4-(2-(1-Pyrrolidinyl)ethyl)phenyl}amine Dihydrochloride. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 2,5g.
4-(2-pyrrolidin-1-ylethyl)aniline;dihydrochloride (CAS 1185304-83-9) is a chemical compound with the molecular formula C12H20Cl2N2 and a molecular weight of 263.20 g/mol. IUPAC name: 4-(2-pyrrolidin-1-ylethyl)aniline;dihydrochloride. InChIKey: JVHAUACRELENOK-UHFFFAOYSA-N.
| Molecular formula | C12H20Cl2N2 |
|---|---|
| Molecular weight | 263.20 g/mol |
| IUPAC name | 4-(2-pyrrolidin-1-ylethyl)aniline;dihydrochloride |
| InChIKey | JVHAUACRELENOK-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCC2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)