CAS 2055848-89-8 appears in our catalog under these names: (S)-2-Phenethyl-piperazine dihydrochloride, 95%, (S)–2–Phenethylpiperazine dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(2S)-2-(2-phenylethyl)piperazine;dihydrochloride (CAS 2055848-89-8) is a chemical compound with the molecular formula C12H20Cl2N2 and a molecular weight of 263.20 g/mol. IUPAC name: (2S)-2-(2-phenylethyl)piperazine;dihydrochloride. InChIKey: GNCMVWAICYVFJG-LTCKWSDVSA-N.
| Molecular formula | C12H20Cl2N2 |
|---|---|
| Molecular weight | 263.20 g/mol |
| IUPAC name | (2S)-2-(2-phenylethyl)piperazine;dihydrochloride |
| InChIKey | GNCMVWAICYVFJG-LTCKWSDVSA-N |
| SMILES | C1CN[C@H](CN1)CCC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)