cas: 119-51-7 — see every product listed under this CAS number, including other names
1-Phenyl-1,2-propanedione-2-oxime, 99% (CAS 119-51-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 205020100 |
| cas | 119-51-7 |
| size | 10g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 146.11 Pln | |
| Thermo Scientific (Acros) | 25g | 268.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
(2E)-2-hydroxyimino-1-phenylpropan-1-one (CAS 119-51-7) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (2E)-2-hydroxyimino-1-phenylpropan-1-one. InChIKey: YPINLRNGSGGJJT-JXMROGBWSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (2E)-2-hydroxyimino-1-phenylpropan-1-one |
| InChIKey | YPINLRNGSGGJJT-JXMROGBWSA-N |
| SMILES | C/C(=N\O)/C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)