Products 732922-86-0

CAS 732922-86-0 appears in our catalog under these names: 2,3-Dihydro-1h-indole-6-carboxylic acid, 96%, Indoline-6-carboxylic acid, 97%, Indoline-6-carboxylic acid 96%, 2,3-Dihydro-1H-indole-6-carboxylic acid, 96%, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,3-dihydro-1H-indole-6-carboxylic acid (CAS 732922-86-0) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: 2,3-dihydro-1H-indole-6-carboxylic acid. InChIKey: ASVKTLFPLKXCBR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO2
Molecular weight163.17 g/mol
IUPAC name2,3-dihydro-1H-indole-6-carboxylic acid
InChIKeyASVKTLFPLKXCBR-UHFFFAOYSA-N
SMILESC1CNC2=C1C=CC(=C2)C(=O)O

Computed by PubChem (NCBI)