CAS 6319-06-8 appears in our catalog under these names: 3A,4,7,7A-Tetrahydro-1h-4,7-methanoisoindole-1,3(2h)-dione, 95%, cis-exo-5-Norbornene-2,3-Dicarboximide, Noreximide 95%, 5-Norbornene-2,3-dicarboximide, exo- (8CI), 95%, 95%. Offered by: Combi-blocks, Chemat Brand, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, on request, 250mg, 25g.
(1R,2R,6S,7S)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 6319-06-8) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (1R,2R,6S,7S)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: GPIUUMROPXDNRH-RNGGSSJXSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (1R,2R,6S,7S)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | GPIUUMROPXDNRH-RNGGSSJXSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@H]3[C@@H]2C(=O)NC3=O |
Computed by PubChem (NCBI)