cas: 1021-25-6 — see every product listed under this CAS number, including other names
1-Phenyl-1,3,8-triaza-spiro[4,5]decan-4-one, 95% (CAS 1021-25-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011834-25G |
| cas | 1021-25-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 9322.78 Pln | |
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 518.59 Pln | |
| Fluorochem | 5g | 2111.77 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 95% |
1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (CAS 1021-25-6) is a chemical compound with the molecular formula C13H17N3O and a molecular weight of 231.29 g/mol. IUPAC name: 1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one. InChIKey: HTQWGIHCFPWKAS-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| InChIKey | HTQWGIHCFPWKAS-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C(=O)NCN2C3=CC=CC=C3 |
Computed by PubChem (NCBI)