cas: 1021-25-6 — see every product listed under this CAS number, including other names
1-Phenyl-1,3,8-triazaspiro[4.5]decan-4-one 97% (CAS 1021-25-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A126666-100mg |
| cas | 1021-25-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 2094.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A126666 |
1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (CAS 1021-25-6) is a chemical compound with the molecular formula C13H17N3O and a molecular weight of 231.29 g/mol. IUPAC name: 1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one. InChIKey: HTQWGIHCFPWKAS-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| InChIKey | HTQWGIHCFPWKAS-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C(=O)NCN2C3=CC=CC=C3 |
Computed by PubChem (NCBI)