cas: 1021-25-6 — see every product listed under this CAS number, including other names
1-Phenyl-1,3,8-triazaspiro[4.5]decan-4-one, 98%, 98% (CAS 1021-25-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1117MM-100mg |
| cas | 1021-25-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1792.40 Pln | |
| Chemat | 25g | 7370.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (CAS 1021-25-6) is a chemical compound with the molecular formula C13H17N3O and a molecular weight of 231.29 g/mol. IUPAC name: 1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one. InChIKey: HTQWGIHCFPWKAS-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| InChIKey | HTQWGIHCFPWKAS-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C(=O)NCN2C3=CC=CC=C3 |
Computed by PubChem (NCBI)