cas: 86770-76-5 — see every product listed under this CAS number, including other names
1-Phenyl-2,5,8,11-tetraoxatridecan-13-amine, 96%, 96% (CAS 86770-76-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115N4D-100mg |
| cas | 86770-76-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 947.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethanamine (CAS 86770-76-5) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethanamine. InChIKey: IYODTXXMZZZHEJ-UHFFFAOYSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethanamine |
| InChIKey | IYODTXXMZZZHEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCCOCCOCCN |
Computed by PubChem (NCBI)