cas: 86770-76-5 — see every product listed under this CAS number, including other names
Benzyl-PEG4-amine 97% (CAS 86770-76-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A106299-250mg |
| cas | 86770-76-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 1087.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A106299 |
2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethanamine (CAS 86770-76-5) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethanamine. InChIKey: IYODTXXMZZZHEJ-UHFFFAOYSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethanamine |
| InChIKey | IYODTXXMZZZHEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCCOCCOCCN |
Computed by PubChem (NCBI)