cas: 36914-69-9 — see every product listed under this CAS number, including other names
1-Phenyl-2-pyrazin-2-yl ethanol (CAS 36914-69-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023539-1G |
| cas | 36914-69-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 945.52 Pln | |
| Fluorochem | 5g | 2632.42 Pln |
| delivery time | 2-3 weeks |
|---|
1-phenyl-2-pyrazin-2-ylethanol (CAS 36914-69-9) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: 1-phenyl-2-pyrazin-2-ylethanol. InChIKey: GCLRAFFYSKHBNT-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 1-phenyl-2-pyrazin-2-ylethanol |
| InChIKey | GCLRAFFYSKHBNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC2=NC=CN=C2)O |
Computed by PubChem (NCBI)