cas: 31378-03-7 — see every product listed under this CAS number, including other names
1-Phenyl-2-tosylethanone, 97%, 97% (CAS 31378-03-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F50-1g |
| cas | 31378-03-7 |
| size | 1g |
| availability | 475g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 25g | 938.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-methylphenyl)sulfonyl-1-phenylethanone (CAS 31378-03-7) is a chemical compound with the molecular formula C15H14O3S and a molecular weight of 274.3 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonyl-1-phenylethanone. InChIKey: RFQXSRPFYWMUDV-UHFFFAOYSA-N.
| Molecular formula | C15H14O3S |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonyl-1-phenylethanone |
| InChIKey | RFQXSRPFYWMUDV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)