CAS 947701-71-5 appears in our catalog under these names: 3-(3,4-Dimethoxyphenyl)-1-(3-thienyl)prop-2-en-1-one, 95%, 3-(3,4-Dimethoxyphenyl)-1-(3-thienyl)prop-2-en-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 25g.
(E)-3-(3,4-dimethoxyphenyl)-1-thiophen-3-ylprop-2-en-1-one (CAS 947701-71-5) is a chemical compound with the molecular formula C15H14O3S and a molecular weight of 274.3 g/mol. IUPAC name: (E)-3-(3,4-dimethoxyphenyl)-1-thiophen-3-ylprop-2-en-1-one. InChIKey: RKPIVDJRGWSFOE-HWKANZROSA-N.
| Molecular formula | C15H14O3S |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | (E)-3-(3,4-dimethoxyphenyl)-1-thiophen-3-ylprop-2-en-1-one |
| InChIKey | RKPIVDJRGWSFOE-HWKANZROSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)C2=CSC=C2)OC |
Computed by PubChem (NCBI)